CAS 1831830-20-6 appears in our catalog under these names: IL-15-IN-1/ 99.28% (existing batch purity), IL–15–IN–1, Il-15-in-1, IL-15-IN-1, 98%, 98%, IL-15-IN-1, 99.79%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
Ethyl 3-[8-[[4-methyl-5-[(3-methyl-4-oxophthalazin-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]octanoylamino]benzoate (CAS 1831830-20-6) is a chemical compound with the molecular formula C30H36N6O4S and a molecular weight of 576.7 g/mol. IUPAC name: ethyl 3-[8-[[4-methyl-5-[(3-methyl-4-oxophthalazin-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]octanoylamino]benzoate. InChIKey: GWNFQAKCJYEJEW-UHFFFAOYSA-N.
| Molecular formula | C30H36N6O4S |
|---|---|
| Molecular weight | 576.7 g/mol |
| IUPAC name | ethyl 3-[8-[[4-methyl-5-[(3-methyl-4-oxophthalazin-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]octanoylamino]benzoate |
| InChIKey | GWNFQAKCJYEJEW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)NC(=O)CCCCCCCSC2=NN=C(N2C)CC3=NN(C(=O)C4=CC=CC=C43)C |
Computed by PubChem (NCBI)