CAS 245747-10-8 appears in our catalog under these names: IL–2–IN–1, IL-2-IN-1/ 99.6% (existing batch purity), IL-2-IN-1, 95%, 95%, IL-2-IN-1, 99.95%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 500mg, 250mg.
N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide (CAS 245747-10-8) is a chemical compound with the molecular formula C17H12F6N4O2 and a molecular weight of 418.29 g/mol. IUPAC name: N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide. InChIKey: LAHVQXKWWOOVLX-UHFFFAOYSA-N.
| Molecular formula | C17H12F6N4O2 |
|---|---|
| Molecular weight | 418.29 g/mol |
| IUPAC name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| InChIKey | LAHVQXKWWOOVLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C(=O)NC2=CC=C(C=C2)N3C(=CC(=N3)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)