CAS 2305750-23-4 appears in our catalog under these names: IM-250/ 99.59% (existing batch purity), IM–250, IM-250, Adibelivir, 99.94%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 5 mg.
2-[4-(2,5-difluorophenyl)phenyl]-N-methyl-N-[4-methyl-5-(methylsulfonimidoyl)-1,3-thiazol-2-yl]acetamide (CAS 2305750-23-4) is a chemical compound with the molecular formula C20H19F2N3O2S2 and a molecular weight of 435.5 g/mol. IUPAC name: 2-[4-(2,5-difluorophenyl)phenyl]-N-methyl-N-[4-methyl-5-(methylsulfonimidoyl)-1,3-thiazol-2-yl]acetamide. InChIKey: JDZTWDISDHLKCR-UHFFFAOYSA-N.
| Molecular formula | C20H19F2N3O2S2 |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | 2-[4-(2,5-difluorophenyl)phenyl]-N-methyl-N-[4-methyl-5-(methylsulfonimidoyl)-1,3-thiazol-2-yl]acetamide |
| InChIKey | JDZTWDISDHLKCR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N(C)C(=O)CC2=CC=C(C=C2)C3=C(C=CC(=C3)F)F)S(=N)(=O)C |
Computed by PubChem (NCBI)