CAS 64009-84-3 appears in our catalog under these names: IMB–301, IMB-301/ 99.32% (existing batch purity), IMB-301, IMB-301, 99.08%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 1mg, 50mg, 100mg, 200mg.
1-[2-(2,4-dichlorophenyl)-4-(4-fluorophenoxy)butyl]imidazole (CAS 64009-84-3) is a chemical compound with the molecular formula C19H17Cl2FN2O and a molecular weight of 379.3 g/mol. IUPAC name: 1-[2-(2,4-dichlorophenyl)-4-(4-fluorophenoxy)butyl]imidazole. InChIKey: FHKXBOJPHOEMQO-UHFFFAOYSA-N.
| Molecular formula | C19H17Cl2FN2O |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 1-[2-(2,4-dichlorophenyl)-4-(4-fluorophenoxy)butyl]imidazole |
| InChIKey | FHKXBOJPHOEMQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCCC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)F |
Computed by PubChem (NCBI)