CAS 439144-66-8 appears in our catalog under these names: IMD-0560/ 99.78% (existing batch purity), IMD-0560, IMD-0560 98%, IMD-0560, 98.73%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
N-[2,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxybenzamide (CAS 439144-66-8) is a chemical compound with the molecular formula C15H8BrF6NO2 and a molecular weight of 428.12 g/mol. IUPAC name: N-[2,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxybenzamide. InChIKey: SVGRIJCSKWXOPA-UHFFFAOYSA-N.
| Molecular formula | C15H8BrF6NO2 |
|---|---|
| Molecular weight | 428.12 g/mol |
| IUPAC name | N-[2,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxybenzamide |
| InChIKey | SVGRIJCSKWXOPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)NC(=O)C2=C(C=CC(=C2)Br)O)C(F)(F)F |
Computed by PubChem (NCBI)