CAS 218795-74-5 appears in our catalog under these names: IMM-01/ 98.81% (existing batch purity), IMM 01, IMM-01, IMM-01 99%, IMM-01, 98.87% ,, 98.87% ,. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
1-tert-butyl-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]thiourea (CAS 218795-74-5) is a chemical compound with the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. IUPAC name: 1-tert-butyl-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]thiourea. InChIKey: LTFUAYRGVLQXKC-NTUHNPAUSA-N.
| Molecular formula | C12H17N3O2S |
|---|---|
| Molecular weight | 267.35 g/mol |
| IUPAC name | 1-tert-butyl-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]thiourea |
| InChIKey | LTFUAYRGVLQXKC-NTUHNPAUSA-N |
| SMILES | CC(C)(C)NC(=S)N/N=C/C1=C(C=C(C=C1)O)O |
Computed by PubChem (NCBI)