CAS 1820787-94-7 appears in our catalog under these names: IRAK4-IN-1/ 98.18% (existing batch purity), IRAK4–IN–1, IRAK4-IN-1, IRAK4-IN-1, 99%, 99%, IRAK4-IN-1, 99.62%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
4-[(4-morpholin-4-ylcyclohexyl)amino]quinazoline-6-carbonitrile (CAS 1820787-94-7) is a chemical compound with the molecular formula C19H23N5O and a molecular weight of 337.4 g/mol. IUPAC name: 4-[(4-morpholin-4-ylcyclohexyl)amino]quinazoline-6-carbonitrile. InChIKey: HVQXFGHHSFTACS-UHFFFAOYSA-N.
| Molecular formula | C19H23N5O |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 4-[(4-morpholin-4-ylcyclohexyl)amino]quinazoline-6-carbonitrile |
| InChIKey | HVQXFGHHSFTACS-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NC2=NC=NC3=C2C=C(C=C3)C#N)N4CCOCC4 |
Computed by PubChem (NCBI)