CAS 2407652-42-8 appears in our catalog under these names: IRG1-IN-1/ 99.36% (existing batch purity), IRG1–IN–1, IRG1-IN-1, IRG1-IN-1, 99.82%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 100mg, 25mg, 50mg, 25 mg.
(3Z)-2-benzyl-3-[(4-fluorophenyl)methylidene]butanedioic acid (CAS 2407652-42-8) is a chemical compound with the molecular formula C18H15FO4 and a molecular weight of 314.3 g/mol. IUPAC name: (3Z)-2-benzyl-3-[(4-fluorophenyl)methylidene]butanedioic acid. InChIKey: DZXOXUPVMSOERA-WJDWOHSUSA-N.
| Molecular formula | C18H15FO4 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | (3Z)-2-benzyl-3-[(4-fluorophenyl)methylidene]butanedioic acid |
| InChIKey | DZXOXUPVMSOERA-WJDWOHSUSA-N |
| SMILES | C1=CC=C(C=C1)CC(/C(=C/C2=CC=C(C=C2)F)/C(=O)O)C(=O)O |
Computed by PubChem (NCBI)