Products 912789-08-3
CAS 912789-08-3 appears in our catalog under these names: ISX–3, ISX-3, ISX-3, 99.68%, ISX-3/ 99.32% (existing batch purity). Offered by: GLPBio, Chemat, MedChemExpress, TargetMol. Available pack sizes: 10mg, 100mg, 25mg, 50mg, 1mg, 5mg, 10mM/1mL, 50 mg.
5-(3-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,2-oxazole-3-carboxamide (CAS 912789-08-3) is a chemical compound with the molecular formula C16H15ClN4O2 and a molecular weight of 330.77 g/mol. IUPAC name: 5-(3-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,2-oxazole-3-carboxamide. InChIKey: DPAAHSSAGAOLBZ-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN4O2 |
|---|---|
| Molecular weight | 330.77 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,2-oxazole-3-carboxamide |
| InChIKey | DPAAHSSAGAOLBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC(=NO2)C(=O)NCCCN3C=CN=C3 |
Computed by PubChem (NCBI)