Products 1099644-42-4
CAS 1099644-42-4 appears in our catalog under these names: Ethyl 4-([1,1'-biphenyl]-4-yl)-2,7,7-trimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate, 98%, ITD-1/ 99.89% (existing batch purity), ITD 1, ITD 1, ITD-1 98%. Offered by: Fluorochem, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 5mg, 50mg, 2mg, 10mg, 25mg, 100mg, 10mM (in 1ml dmso), 1mg.
Ethyl 2,7,7-trimethyl-5-oxo-4-(4-phenylphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate (CAS 1099644-42-4) is a chemical compound with the molecular formula C27H29NO3 and a molecular weight of 415.5 g/mol. IUPAC name: ethyl 2,7,7-trimethyl-5-oxo-4-(4-phenylphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate. InChIKey: ULFUJLFTRWWLPO-UHFFFAOYSA-N.
| Molecular formula | C27H29NO3 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | ethyl 2,7,7-trimethyl-5-oxo-4-(4-phenylphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| InChIKey | ULFUJLFTRWWLPO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC2=C(C1C3=CC=C(C=C3)C4=CC=CC=C4)C(=O)CC(C2)(C)C)C |
Computed by PubChem (NCBI)