CAS 133208-93-2 appears in our catalog under these names: NO–1886, Ibrolipim/ 99.47% (existing batch purity), Ibrolipim 99%, Diethyl [[4-[[(4-bromo-2-cyanophenyl)amino]carbonyl]phenyl]methyl]phosphonate, 99%, 99%, Ibrolipim, 99.48%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 200mg, 1mg.
N-(4-bromo-2-cyanophenyl)-4-(diethoxyphosphorylmethyl)benzamide (CAS 133208-93-2) is a chemical compound with the molecular formula C19H20BrN2O4P and a molecular weight of 451.2 g/mol. IUPAC name: N-(4-bromo-2-cyanophenyl)-4-(diethoxyphosphorylmethyl)benzamide. InChIKey: KPRTURMJVWXURQ-UHFFFAOYSA-N.
| Molecular formula | C19H20BrN2O4P |
|---|---|
| Molecular weight | 451.2 g/mol |
| IUPAC name | N-(4-bromo-2-cyanophenyl)-4-(diethoxyphosphorylmethyl)benzamide |
| InChIKey | KPRTURMJVWXURQ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)Br)C#N)OCC |
Computed by PubChem (NCBI)