CAS 1334546-77-8 appears in our catalog under these names: Icenticaftor/ 98.39% (existing batch purity), Icenticaftor, Icenticaftor 98%, Icenticaftor, 98%, 98%, Icenticaftor, 99.66%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg.
3-amino-6-methoxy-N-[(2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]-5-(trifluoromethyl)pyridine-2-carboxamide (CAS 1334546-77-8) is a chemical compound with the molecular formula C12H13F6N3O3 and a molecular weight of 361.24 g/mol. IUPAC name: 3-amino-6-methoxy-N-[(2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]-5-(trifluoromethyl)pyridine-2-carboxamide. InChIKey: USHQRIKZLHNPQR-JTQLQIEISA-N.
| Molecular formula | C12H13F6N3O3 |
|---|---|
| Molecular weight | 361.24 g/mol |
| IUPAC name | 3-amino-6-methoxy-N-[(2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| InChIKey | USHQRIKZLHNPQR-JTQLQIEISA-N |
| SMILES | C[C@](CNC(=O)C1=C(C=C(C(=N1)OC)C(F)(F)F)N)(C(F)(F)F)O |
Computed by PubChem (NCBI)