CAS 1239358-86-1 appears in our catalog under these names: Ilginatinib/ 99.43% (existing batch purity), Ilginatinib (NS–018), Ilginatinib, NS-018, 98%, 98%, Ilginatinib, 99.94%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
6-N-[(1S)-1-(4-fluorophenyl)ethyl]-4-(1-methylpyrazol-4-yl)-2-N-pyrazin-2-ylpyridine-2,6-diamine (CAS 1239358-86-1) is a chemical compound with the molecular formula C21H20FN7 and a molecular weight of 389.4 g/mol. IUPAC name: 6-N-[(1S)-1-(4-fluorophenyl)ethyl]-4-(1-methylpyrazol-4-yl)-2-N-pyrazin-2-ylpyridine-2,6-diamine. InChIKey: UQTPDWDAYHAZNT-AWEZNQCLSA-N.
| Molecular formula | C21H20FN7 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 6-N-[(1S)-1-(4-fluorophenyl)ethyl]-4-(1-methylpyrazol-4-yl)-2-N-pyrazin-2-ylpyridine-2,6-diamine |
| InChIKey | UQTPDWDAYHAZNT-AWEZNQCLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)F)NC2=CC(=CC(=N2)NC3=NC=CN=C3)C4=CN(N=C4)C |
Computed by PubChem (NCBI)