CAS 75689-93-9 appears in our catalog under these names: Imanixil/ 99.48% (existing batch purity), Imanixil, 4-Amino-3-ethoxybenzenesulfonic acid, Imanixil, 99.29%, Imanixil (Standard). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL.
4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide (CAS 75689-93-9) is a chemical compound with the molecular formula C17H17F3N6O2 and a molecular weight of 394.4 g/mol. IUPAC name: 4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide. InChIKey: FUSNOPLQVRUIIM-UHFFFAOYSA-N.
| Molecular formula | C17H17F3N6O2 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide |
| InChIKey | FUSNOPLQVRUIIM-UHFFFAOYSA-N |
| SMILES | CC1(CN(C(=O)N1)C2=NC=C(C(=N2)N)C(=O)NC3=CC=CC(=C3)C(F)(F)F)C |
Computed by PubChem (NCBI)