cas: 775351-61-6 — see every product listed under this CAS number, including other names
Imeglimin HCl 98% (CAS 775351-61-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A613391-1mg |
| cas | 775351-61-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 164.56 Pln | |
| Ambeed | 5mg | 248.00 Pln | |
| Ambeed | 10mg | 309.19 Pln | |
| Ambeed | 50mg | 743.06 Pln | |
| Ambeed | 100mg | 1121.31 Pln | |
| Ambeed | 250mg | 1794.38 Pln | |
| Ambeed | 1g | 4714.69 Pln | |
| Ambeed | 5g | 14004.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A613391 |
(4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride (CAS 775351-61-6) is a chemical compound with the molecular formula C6H14ClN5 and a molecular weight of 191.66 g/mol. IUPAC name: (4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride. InChIKey: UXHLCYMTNMEXKZ-PGMHMLKASA-N.
| Molecular formula | C6H14ClN5 |
|---|---|
| Molecular weight | 191.66 g/mol |
| IUPAC name | (4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride |
| InChIKey | UXHLCYMTNMEXKZ-PGMHMLKASA-N |
| SMILES | C[C@@H]1N=C(NC(=N1)N(C)C)N.Cl |
Computed by PubChem (NCBI)