CAS 775351-61-6 appears in our catalog under these names: Imeglimin HCl, R-Imeglimin Hydrochloride, Imeglimin hydrochloride, Imeglimin hydrochloride/ 99.75% (existing batch purity), Imeglimin hydrochloride. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 25mg, 10mg, 100mg, 2mg, 5mg, 10mM (in 1ml dmso), 50mg.
(4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride (CAS 775351-61-6) is a chemical compound with the molecular formula C6H14ClN5 and a molecular weight of 191.66 g/mol. IUPAC name: (4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride. InChIKey: UXHLCYMTNMEXKZ-PGMHMLKASA-N.
| Molecular formula | C6H14ClN5 |
|---|---|
| Molecular weight | 191.66 g/mol |
| IUPAC name | (4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride |
| InChIKey | UXHLCYMTNMEXKZ-PGMHMLKASA-N |
| SMILES | C[C@@H]1N=C(NC(=N1)N(C)C)N.Cl |
Computed by PubChem (NCBI)