CAS 775351-65-0 appears in our catalog under these names: Imeglimin/ 98.97% (existing batch purity), Imeglimin, Imeglimin, 99.10%, Imeglimin, ≥99%, ≥99%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 100 mg.
(4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine (CAS 775351-65-0) is a chemical compound with the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. IUPAC name: (4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine. InChIKey: GFICWFZTBXUVIG-SCSAIBSYSA-N.
| Molecular formula | C6H13N5 |
|---|---|
| Molecular weight | 155.20 g/mol |
| IUPAC name | (4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| InChIKey | GFICWFZTBXUVIG-SCSAIBSYSA-N |
| SMILES | C[C@@H]1N=C(NC(=N1)N(C)C)N |
Computed by PubChem (NCBI)