cas: 499770-78-4 — see every product listed under this CAS number, including other names
Imidazo[1,2-a]pyridine-3-sulfonyl chloride 95% (CAS 499770-78-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A746276-250mg |
| cas | 499770-78-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1043.44 Pln | |
| Ambeed | 5g | 3535.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A746276 |
Imidazo[1,2-a]pyridine-3-sulfonyl chloride (CAS 499770-78-4) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: imidazo[1,2-a]pyridine-3-sulfonyl chloride. InChIKey: YUTXXNKKOHPXOL-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | imidazo[1,2-a]pyridine-3-sulfonyl chloride |
| InChIKey | YUTXXNKKOHPXOL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)