cas: 499770-78-4 — see every product listed under this CAS number, including other names
Imidazo[1,2-a]pyridine-3-sulfonyl chloride, 95%, 95% (CAS 499770-78-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117X41-250mg |
| cas | 499770-78-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2478.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Imidazo[1,2-a]pyridine-3-sulfonyl chloride (CAS 499770-78-4) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: imidazo[1,2-a]pyridine-3-sulfonyl chloride. InChIKey: YUTXXNKKOHPXOL-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | imidazo[1,2-a]pyridine-3-sulfonyl chloride |
| InChIKey | YUTXXNKKOHPXOL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)