Products 65898-38-6
CAS 65898-38-6 appears in our catalog under these names: 2,3-dihydro-1H-indene-5-carboxylic acid, 98%, 98%, Indan-5-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g.
2,3-dihydro-1H-indene-5-carboxylic acid (CAS 65898-38-6) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: 2,3-dihydro-1H-indene-5-carboxylic acid. InChIKey: FOJQJDBJBNEHTO-UHFFFAOYSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | 2,3-dihydro-1H-indene-5-carboxylic acid |
| InChIKey | FOJQJDBJBNEHTO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)