cas: 138937-28-7 — see every product listed under this CAS number, including other names
Indoline-5,6-diol hydrobromide 97% (CAS 138937-28-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A321539-250mg |
| cas | 138937-28-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1193.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A321539 |
2,3-dihydro-1H-indole-5,6-diol;hydrobromide (CAS 138937-28-7) is a chemical compound with the molecular formula C8H10BrNO2 and a molecular weight of 232.07 g/mol. IUPAC name: 2,3-dihydro-1H-indole-5,6-diol;hydrobromide. InChIKey: TXMQOPNBBITFNX-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2 |
|---|---|
| Molecular weight | 232.07 g/mol |
| IUPAC name | 2,3-dihydro-1H-indole-5,6-diol;hydrobromide |
| InChIKey | TXMQOPNBBITFNX-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C21)O)O.Br |
Computed by PubChem (NCBI)