Indolo[3,2,1-jk]carbazole, 98%
cas: 205-95-8 — see every product listed under this CAS number, including other names
Indolo[3,2,1-jk]carbazole, 98% (CAS 205-95-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 15g, 25g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F695629-250MG |
| cas | 205-95-8 |
| size | 250mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 5g | 617.51 Pln | |
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2500.81 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 395.60 Pln | |
| Chemat | 10g | 712.40 Pln | |
| Chemat | 15g | 1010.00 Pln | |
| Chemat | 25g | 1552.40 Pln | |
| BLDpharm | 100mg | 325.47 Pln | |
| BLDpharm | 250mg | 408.77 Pln | |
| BLDpharm | 1g | 803.08 Pln | |
| BLDpharm | 5g | 2691.30 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaene (CAS 205-95-8) is a chemical compound with the molecular formula C18H11N and a molecular weight of 241.3 g/mol. IUPAC name: 1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaene. InChIKey: SZLNOBJKCVERBJ-UHFFFAOYSA-N.
| Molecular formula | C18H11N |
|---|---|
| Molecular weight | 241.3 g/mol |
| IUPAC name | 1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaene |
| InChIKey | SZLNOBJKCVERBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4N2C5=CC=CC=C5C4=CC=C3 |
Computed by PubChem (NCBI)