CAS 141573-94-6 appears in our catalog under these names: Inpyrfluxam, Concentration: 100 µg/ml Solvent: Acetonitrile, Inpyrfluxam. Offered by: HPC Standards. Available pack sizes: 1x1ml, 1x10mg.
3-(difluoromethyl)-1-methyl-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)pyrazole-4-carboxamide (CAS 141573-94-6) is a chemical compound with the molecular formula C18H21F2N3O and a molecular weight of 333.4 g/mol. IUPAC name: 3-(difluoromethyl)-1-methyl-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)pyrazole-4-carboxamide. InChIKey: YTCIYOXHHQLDEI-UHFFFAOYSA-N.
| Molecular formula | C18H21F2N3O |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 3-(difluoromethyl)-1-methyl-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)pyrazole-4-carboxamide |
| InChIKey | YTCIYOXHHQLDEI-UHFFFAOYSA-N |
| SMILES | CC1CC(C2=C1C(=CC=C2)NC(=O)C3=CN(N=C3C(F)F)C)(C)C |
Computed by PubChem (NCBI)