CAS 355-69-1 appears in our catalog under these names: Iodoperfluorocyclohexane, 98%, Undecafluoroiodocyclohexane (stabilized with Copper chip), Undecafluoroiodocyclohexane (stabilized with Copper chip), >98.0%(GC), Iodoperfluorocyclohexane, 97%. Offered by: Combi-blocks, GLPBio, TCI, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-iodocyclohexane (CAS 355-69-1) is a chemical compound with the molecular formula C6F11I and a molecular weight of 407.95 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-iodocyclohexane. InChIKey: WYRAAMGCHCLHRD-UHFFFAOYSA-N.
| Molecular formula | C6F11I |
|---|---|
| Molecular weight | 407.95 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-iodocyclohexane |
| InChIKey | WYRAAMGCHCLHRD-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C(C1(F)F)(F)F)(F)I)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)