CAS 120695-78-5 is the registry number for 1-Iodo-4-(trifluoromethyl)octafluoropent-2-ene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-1,1,2,3,4,5,5,5-octafluoro-1-iodo-4-(trifluoromethyl)pent-2-ene (CAS 120695-78-5) is a chemical compound with the molecular formula C6F11I and a molecular weight of 407.95 g/mol. IUPAC name: (E)-1,1,2,3,4,5,5,5-octafluoro-1-iodo-4-(trifluoromethyl)pent-2-ene. InChIKey: BJZGOHYMGKSXBU-OWOJBTEDSA-N.
| Molecular formula | C6F11I |
|---|---|
| Molecular weight | 407.95 g/mol |
| IUPAC name | (E)-1,1,2,3,4,5,5,5-octafluoro-1-iodo-4-(trifluoromethyl)pent-2-ene |
| InChIKey | BJZGOHYMGKSXBU-OWOJBTEDSA-N |
| SMILES | C(=C(/C(F)(F)I)\F)(\C(C(F)(F)F)(C(F)(F)F)F)/F |
Computed by PubChem (NCBI)