CAS 305-33-9 appears in our catalog under these names: Iproniazid Phosphate, Iproniazid Phosphate/ 99.87% (existing batch purity), Iproniazid (phosphate), 99.92%, Iproniazid (phosphate) (Standard), N'-Isopropylisonicotinohydrazide phosphate, 95%. Offered by: Mikromol, LoGiCal, TargetMol, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 10mg, 1g, 200mg, 500mg, 50 mg, 100 mg, 10mM/1mL.
Phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide (CAS 305-33-9) is a chemical compound with the molecular formula C9H16N3O5P and a molecular weight of 277.21 g/mol. IUPAC name: phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide. InChIKey: YPDVTKJXVHYWFY-UHFFFAOYSA-N.
| Molecular formula | C9H16N3O5P |
|---|---|
| Molecular weight | 277.21 g/mol |
| IUPAC name | phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide |
| InChIKey | YPDVTKJXVHYWFY-UHFFFAOYSA-N |
| SMILES | CC(C)NNC(=O)C1=CC=NC=C1.OP(=O)(O)O |
Computed by PubChem (NCBI)