Products 67451-73-4
CAS 67451-73-4 appears in our catalog under these names: Isoasatone A/ 99.21% (existing batch purity), Isoasatone A, Isoasatone A, Isoasatone A, 99.86%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(1S,2S,8R)-3,3,5,8,10,10-hexamethoxy-11-[(E)-prop-1-enyl]-7-prop-2-enyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione (CAS 67451-73-4) is a chemical compound with the molecular formula C24H32O8 and a molecular weight of 448.5 g/mol. IUPAC name: (1S,2S,8R)-3,3,5,8,10,10-hexamethoxy-11-[(E)-prop-1-enyl]-7-prop-2-enyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione. InChIKey: JSAXPXNTZVWWDV-PGNHJLLYSA-N.
| Molecular formula | C24H32O8 |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | (1S,2S,8R)-3,3,5,8,10,10-hexamethoxy-11-[(E)-prop-1-enyl]-7-prop-2-enyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| InChIKey | JSAXPXNTZVWWDV-PGNHJLLYSA-N |
| SMILES | C/C=C/C1=C[C@@]2(C(=O)C([C@H]1[C@H]3C2(C=C(C(=O)C3(OC)OC)OC)CC=C)(OC)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Isoasatone A