CAS 124-76-5 appears in our catalog under these names: Isoborneol, >95% (GC), Isoborneol, Isoborneol/ 98%, (±)-Isoborneol, 95% , DL-Isoborneol. Offered by: TRC, Dr. Ehrenstorfer, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 10g, 1g, 50g, 100mg, 500mg, 25g, 100g, 500g.
(1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (CAS 124-76-5) is a chemical compound with the molecular formula C10H18O and a molecular weight of 154.25 g/mol. IUPAC name: (1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol. InChIKey: DTGKSKDOIYIVQL-MRTMQBJTSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | (1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| InChIKey | DTGKSKDOIYIVQL-MRTMQBJTSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)C[C@H]2O |
Computed by PubChem (NCBI)