Isoindoline-4-carbonitrile hydrochloride, 97%
cas: 1159825-57-6 — see every product listed under this CAS number, including other names
Isoindoline-4-carbonitrile hydrochloride, 97% (CAS 1159825-57-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A332049-100mg |
| cas | 1159825-57-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 876.56 Pln | |
| Ambeed | 250mg | 1282.62 Pln | |
| Ambeed | 1g | 2517.50 Pln | |
| Ambeed | 5g | 7401.38 Pln | |
| Chemat | 100mg | 650.00 Pln | |
| Chemat | 250mg | 942.80 Pln | |
| Chemat | 1g | 1835.60 Pln | |
| Chemat | 5g | 7442.00 Pln | |
| BLDpharm | 100mg | 936.36 Pln | |
| BLDpharm | 250mg | 1375.10 Pln | |
| BLDpharm | 1g | 2707.96 Pln | |
| BLDpharm | 5g | 7972.77 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2,3-dihydro-1H-isoindole-4-carbonitrile;hydrochloride (CAS 1159825-57-6) is a chemical compound with the molecular formula C9H9ClN2 and a molecular weight of 180.63 g/mol. IUPAC name: 2,3-dihydro-1H-isoindole-4-carbonitrile;hydrochloride. InChIKey: XVJQMFRHWPSTDY-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2 |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 2,3-dihydro-1H-isoindole-4-carbonitrile;hydrochloride |
| InChIKey | XVJQMFRHWPSTDY-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C(=CC=C2)C#N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2,3-dihydro-1h-isoindole-4-carbonitrile hydrochloride, Isoindoline-4-carbonitrile hydrochloride, 4-Cyano-isoindoline HCl, 4-Cyano-isoindoline hydrochloride, Isoindoline-4-carbonitrilehydrochloride, 2,3-dihydro-1H-isoindole-4-carbonitrile;hydrochloride, XVJQMFRHWPSTDY-UHFFFAOYSA-N, 4-cyanoisoindoline hydrogen chloride, isoindoline-4-carbonitrile;hydrochloride, 4-Cyano-isoindoline hydrochloride, AldrichCPR
