CAS 960527-22-4 appears in our catalog under these names: Isothiafludine/ 99.65% (existing batch purity), Isothiafludine, Isothiafludine, 99.87%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 25 mg, 5 mg.
N-[(4-fluorophenyl)methyl]-5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide (CAS 960527-22-4) is a chemical compound with the molecular formula C18H18FN3OS2 and a molecular weight of 375.5 g/mol. IUPAC name: N-[(4-fluorophenyl)methyl]-5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide. InChIKey: DPHPCLGZSLZAGL-UHFFFAOYSA-N.
| Molecular formula | C18H18FN3OS2 |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | N-[(4-fluorophenyl)methyl]-5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
| InChIKey | DPHPCLGZSLZAGL-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=C(N=C(S1)C2=NC=CS2)C(=O)NCC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)