CAS 252870-53-4 appears in our catalog under these names: Ispronicline/ 96.54% (existing batch purity), Ispronicline, Ispronicline(TC-1734,AZD-3480), Ispronicline, 98.24%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
(E,2S)-N-methyl-5-(5-propan-2-yloxy-3-pyridinyl)pent-4-en-2-amine (CAS 252870-53-4) is a chemical compound with the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. IUPAC name: (E,2S)-N-methyl-5-(5-propan-2-yloxy-3-pyridinyl)pent-4-en-2-amine. InChIKey: RPCVIAXDAUMJJP-PZBABLGHSA-N.
| Molecular formula | C14H22N2O |
|---|---|
| Molecular weight | 234.34 g/mol |
| IUPAC name | (E,2S)-N-methyl-5-(5-propan-2-yloxy-3-pyridinyl)pent-4-en-2-amine |
| InChIKey | RPCVIAXDAUMJJP-PZBABLGHSA-N |
| SMILES | C[C@@H](C/C=C/C1=CC(=CN=C1)OC(C)C)NC |
Computed by PubChem (NCBI)