CAS 749269-83-8 appears in our catalog under these names: 1-[4-(3,4-dichlorophenyl)-3-fluorophenyl]cyclopropane-1-carboxylic acid, 95%, Itanapraced/ 98%, Itanapraced (CHF5074), Itanapraced, CHF 5074, 96%, 96%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
1-[4-(3,4-dichlorophenyl)-3-fluorophenyl]cyclopropane-1-carboxylic acid (CAS 749269-83-8) is a chemical compound with the molecular formula C16H11Cl2FO2 and a molecular weight of 325.2 g/mol. IUPAC name: 1-[4-(3,4-dichlorophenyl)-3-fluorophenyl]cyclopropane-1-carboxylic acid. InChIKey: LIYLTQQDABRNRX-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl2FO2 |
|---|---|
| Molecular weight | 325.2 g/mol |
| IUPAC name | 1-[4-(3,4-dichlorophenyl)-3-fluorophenyl]cyclopropane-1-carboxylic acid |
| InChIKey | LIYLTQQDABRNRX-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)C3=CC(=C(C=C3)Cl)Cl)F)C(=O)O |
Computed by PubChem (NCBI)