Products 1303512-02-8
CAS 1303512-02-8 appears in our catalog under these names: Izilendustat/ 99.95% (existing batch purity), Izilendustat, Izilendustat 98%, Izilendustat, 98%, 98%, Izilendustat, 98.01%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10mM/1mL.
Tert-butyl 4-[[1-[(4-chlorophenyl)methyl]-3-hydroxy-2-oxo-4-pyridinyl]methyl]piperazine-1-carboxylate (CAS 1303512-02-8) is a chemical compound with the molecular formula C22H28ClN3O4 and a molecular weight of 433.9 g/mol. IUPAC name: tert-butyl 4-[[1-[(4-chlorophenyl)methyl]-3-hydroxy-2-oxo-4-pyridinyl]methyl]piperazine-1-carboxylate. InChIKey: UPJZLOCUUOIMNC-UHFFFAOYSA-N.
| Molecular formula | C22H28ClN3O4 |
|---|---|
| Molecular weight | 433.9 g/mol |
| IUPAC name | tert-butyl 4-[[1-[(4-chlorophenyl)methyl]-3-hydroxy-2-oxo-4-pyridinyl]methyl]piperazine-1-carboxylate |
| InChIKey | UPJZLOCUUOIMNC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC2=C(C(=O)N(C=C2)CC3=CC=C(C=C3)Cl)O |
Computed by PubChem (NCBI)