CAS 1236666-76-4 appears in our catalog under these names: JAK-STAT-IN-1/ 99.21% (existing batch purity), 2(3H)-Benzoxazolone, 5-[[5-methyl-2-[(3,4,5-trimethylphenyl)amino]-4-pyrimidinyl]amino]-, JAK-STAT-IN-1. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
5-[[5-methyl-2-(3,4,5-trimethylanilino)pyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one (CAS 1236666-76-4) is a chemical compound with the molecular formula C21H21N5O2 and a molecular weight of 375.4 g/mol. IUPAC name: 5-[[5-methyl-2-(3,4,5-trimethylanilino)pyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one. InChIKey: OQGHGKFTKWEBSK-UHFFFAOYSA-N.
| Molecular formula | C21H21N5O2 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 5-[[5-methyl-2-(3,4,5-trimethylanilino)pyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one |
| InChIKey | OQGHGKFTKWEBSK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)C)NC2=NC=C(C(=N2)NC3=CC4=C(C=C3)OC(=O)N4)C |
Computed by PubChem (NCBI)