CAS 1361227-90-8 appears in our catalog under these names: JH-RE-06/ 99.24% (existing batch purity), JH-RE-06, JH-RE-06 99%, 8-Chloro-2-[(2,4-dichlorophenyl)amino]-3-(3-methyl-1-oxobutyl)-5-nitro-4(1H)-quinolinone, 99%, 99%, JH-RE-06, 99.87%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 5 mg.
8-chloro-2-(2,4-dichloroanilino)-3-(3-methylbutanoyl)-5-nitro-1H-quinolin-4-one (CAS 1361227-90-8) is a chemical compound with the molecular formula C20H16Cl3N3O4 and a molecular weight of 468.7 g/mol. IUPAC name: 8-chloro-2-(2,4-dichloroanilino)-3-(3-methylbutanoyl)-5-nitro-1H-quinolin-4-one. InChIKey: LRTXIQCBQIKIOH-UHFFFAOYSA-N.
| Molecular formula | C20H16Cl3N3O4 |
|---|---|
| Molecular weight | 468.7 g/mol |
| IUPAC name | 8-chloro-2-(2,4-dichloroanilino)-3-(3-methylbutanoyl)-5-nitro-1H-quinolin-4-one |
| InChIKey | LRTXIQCBQIKIOH-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=C(NC2=C(C=CC(=C2C1=O)[N+](=O)[O-])Cl)NC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)