CAS 2369979-67-7 appears in our catalog under these names: JHU 37152, JHU37152/ 98.12% (existing batch purity), JHU37152, JHU 37152, 98%, 98%, JHU37152, 99.45%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 2mg, 5mg, 25mg, 100mg, 200mg, 250mg.
3-chloro-6-(4-ethylpiperazin-1-yl)-7-fluoro-11H-benzo[b][1,4]benzodiazepine (CAS 2369979-67-7) is a chemical compound with the molecular formula C19H20ClFN4 and a molecular weight of 358.8 g/mol. IUPAC name: 3-chloro-6-(4-ethylpiperazin-1-yl)-7-fluoro-11H-benzo[b][1,4]benzodiazepine. InChIKey: NZMZJNNWMSYDNX-UHFFFAOYSA-N.
| Molecular formula | C19H20ClFN4 |
|---|---|
| Molecular weight | 358.8 g/mol |
| IUPAC name | 3-chloro-6-(4-ethylpiperazin-1-yl)-7-fluoro-11H-benzo[b][1,4]benzodiazepine |
| InChIKey | NZMZJNNWMSYDNX-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=NC3=C(C=CC(=C3)Cl)NC4=C2C(=CC=C4)F |
Computed by PubChem (NCBI)