CAS 900573-88-8 appears in our catalog under these names: JI-101/ 99.41% (existing batch purity), JI–101, JI-101, JI-101 99%, N-[1-[(2-Amino-4-pyridinyl)methyl]-1H-indol-4-yl]-N'-(5-bromo-2-methoxyphenyl)urea, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 50 mg, 100 mg.
1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-(5-bromo-2-methoxyphenyl)urea (CAS 900573-88-8) is a chemical compound with the molecular formula C22H20BrN5O2 and a molecular weight of 466.3 g/mol. IUPAC name: 1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-(5-bromo-2-methoxyphenyl)urea. InChIKey: ZXBFYBLSJMEBEP-UHFFFAOYSA-N.
| Molecular formula | C22H20BrN5O2 |
|---|---|
| Molecular weight | 466.3 g/mol |
| IUPAC name | 1-[1-[(2-amino-4-pyridinyl)methyl]indol-4-yl]-3-(5-bromo-2-methoxyphenyl)urea |
| InChIKey | ZXBFYBLSJMEBEP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)NC(=O)NC2=C3C=CN(C3=CC=C2)CC4=CC(=NC=C4)N |
Computed by PubChem (NCBI)