CAS 604769-01-9 appears in our catalog under these names: R306465(JNJ–16241199), R306465/ 99.64% (existing batch purity), R306465, N-Hydroxy-2-(4-(naphthalen-2-ylsulfonyl)piperazin-1-yl)pyrimidine-5-carboxamide, 98+%, 98+%, JNJ-16241199, 99.05%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 25mg, 2mg, 50mg, 100mg, 250mg.
N-hydroxy-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide (CAS 604769-01-9) is a chemical compound with the molecular formula C19H19N5O4S and a molecular weight of 413.5 g/mol. IUPAC name: N-hydroxy-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide. InChIKey: MUTBJZVSRNUIHA-UHFFFAOYSA-N.
| Molecular formula | C19H19N5O4S |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | N-hydroxy-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide |
| InChIKey | MUTBJZVSRNUIHA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=NC=C(C=N2)C(=O)NO)S(=O)(=O)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)