Products 1010879-39-6
CAS 1010879-39-6 is the registry number for MAO-B ligand-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-(2,1,3-benzoxadiazol-4-ylsulfonylamino)ethyl]-3-(1H-indol-3-yl)propanamide (CAS 1010879-39-6) is a chemical compound with the molecular formula C19H19N5O4S and a molecular weight of 413.5 g/mol. IUPAC name: N-[2-(2,1,3-benzoxadiazol-4-ylsulfonylamino)ethyl]-3-(1H-indol-3-yl)propanamide. InChIKey: ATBDVMIHFKYZOH-UHFFFAOYSA-N.
| Molecular formula | C19H19N5O4S |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | N-[2-(2,1,3-benzoxadiazol-4-ylsulfonylamino)ethyl]-3-(1H-indol-3-yl)propanamide |
| InChIKey | ATBDVMIHFKYZOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCC(=O)NCCNS(=O)(=O)C3=CC=CC4=NON=C43 |
Computed by PubChem (NCBI)
Synonyms:
MAO-B ligand-1, orb1737476