CAS 877316-38-6 appears in our catalog under these names: JNJ-26990990/ 95%, N-[(1-benzothiophen-3-yl)methyl]aminosulfonamide, JNJ-26990990. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10 mg.
3-[(sulfamoylamino)methyl]-1-benzothiophene (CAS 877316-38-6) is a chemical compound with the molecular formula C9H10N2O2S2 and a molecular weight of 242.3 g/mol. IUPAC name: 3-[(sulfamoylamino)methyl]-1-benzothiophene. InChIKey: AWSKBQNOSRREEY-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S2 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | 3-[(sulfamoylamino)methyl]-1-benzothiophene |
| InChIKey | AWSKBQNOSRREEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)CNS(=O)(=O)N |
Computed by PubChem (NCBI)