CAS 2230598-99-7 appears in our catalog under these names: JNJ-65355394/ 99.55% (existing batch purity), JNJ-65355394. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
N-[5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide (CAS 2230598-99-7) is a chemical compound with the molecular formula C19H26N4OS and a molecular weight of 358.5 g/mol. IUPAC name: N-[5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide. InChIKey: CYFBRQHYEQKYHH-MRXNPFEDSA-N.
| Molecular formula | C19H26N4OS |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | N-[5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
| InChIKey | CYFBRQHYEQKYHH-MRXNPFEDSA-N |
| SMILES | CC1=CC(=CC(=N1)C)C[C@H]2CCCN(C2)CC3=CN=C(S3)NC(=O)C |
Computed by PubChem (NCBI)