CAS 1408064-71-0 appears in our catalog under these names: JNK-IN-7/ 99.58% (existing batch purity), JNK–IN–7, JNK-IN-7, JNK-IN-7 99%, JNK-IN-7, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide (CAS 1408064-71-0) is a chemical compound with the molecular formula C28H27N7O2 and a molecular weight of 493.6 g/mol. IUPAC name: 3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide. InChIKey: RADRIIWGHYFWPP-WEVVVXLNSA-N.
| Molecular formula | C28H27N7O2 |
|---|---|
| Molecular weight | 493.6 g/mol |
| IUPAC name | 3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
| InChIKey | RADRIIWGHYFWPP-WEVVVXLNSA-N |
| SMILES | CN(C)C/C=C/C(=O)NC1=CC=CC(=C1)C(=O)NC2=CC=C(C=C2)NC3=NC=CC(=N3)C4=CN=CC=C4 |
Computed by PubChem (NCBI)