Products 1416133-89-5
CAS 1416133-89-5 appears in our catalog under these names: JW 642, JW 642/ 99.28% (existing batch purity), JW 642, 99%, 99%, JW 642, 99.90%, JW 642 (Standard). Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 50 mg.
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(3-phenoxyphenyl)methyl]piperazine-1-carboxylate (CAS 1416133-89-5) is a chemical compound with the molecular formula C21H20F6N2O3 and a molecular weight of 462.4 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(3-phenoxyphenyl)methyl]piperazine-1-carboxylate. InChIKey: AVSCNEOUWSVZEY-UHFFFAOYSA-N.
| Molecular formula | C21H20F6N2O3 |
|---|---|
| Molecular weight | 462.4 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(3-phenoxyphenyl)methyl]piperazine-1-carboxylate |
| InChIKey | AVSCNEOUWSVZEY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC(=CC=C2)OC3=CC=CC=C3)C(=O)OC(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)