CAS 729-46-4 appears in our catalog under these names: JX06/ 99.66% (existing batch purity), JX 06, JX 06, JX 06, >95.0%(HPLC)(qNMR), JX06 98%. Offered by: TargetMol, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1mg, 1g.
Morpholine-4-carbothioylsulfanyl morpholine-4-carbodithioate (CAS 729-46-4) is a chemical compound with the molecular formula C10H16N2O2S4 and a molecular weight of 324.5 g/mol. IUPAC name: morpholine-4-carbothioylsulfanyl morpholine-4-carbodithioate. InChIKey: KKVYOWPPMNSLCP-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S4 |
|---|---|
| Molecular weight | 324.5 g/mol |
| IUPAC name | morpholine-4-carbothioylsulfanyl morpholine-4-carbodithioate |
| InChIKey | KKVYOWPPMNSLCP-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=S)SSC(=S)N2CCOCC2 |
Computed by PubChem (NCBI)