CAS 339103-05-8 appears in our catalog under these names: JY–2, JY-2/ 99.66% (existing batch purity), 5-(2,4-Dichlorophenyl)-3-(pyridin-2-yl)-1,2,4-oxadiazole, 98%, 98%, JY-2, 99.75%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 250mg, 5 mg, 10 mg.
5-(2,4-dichlorophenyl)-3-pyridin-2-yl-1,2,4-oxadiazole (CAS 339103-05-8) is a chemical compound with the molecular formula C13H7Cl2N3O and a molecular weight of 292.12 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-3-pyridin-2-yl-1,2,4-oxadiazole. InChIKey: WBMHQMQALJDGHI-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2N3O |
|---|---|
| Molecular weight | 292.12 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
| InChIKey | WBMHQMQALJDGHI-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NOC(=N2)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)