CAS 1672691-74-5 appears in our catalog under these names: JZP-430/ 98.31% (existing batch purity), JZP 430, JZP-430 99%, JZP-430, 99%, 99%, JZP-430, 99.74%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl) N-cyclooctyl-N-methylcarbamate (CAS 1672691-74-5) is a chemical compound with the molecular formula C16H26N4O3S and a molecular weight of 354.5 g/mol. IUPAC name: (4-morpholin-4-yl-1,2,5-thiadiazol-3-yl) N-cyclooctyl-N-methylcarbamate. InChIKey: WKSHMJCYWFOADB-UHFFFAOYSA-N.
| Molecular formula | C16H26N4O3S |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | (4-morpholin-4-yl-1,2,5-thiadiazol-3-yl) N-cyclooctyl-N-methylcarbamate |
| InChIKey | WKSHMJCYWFOADB-UHFFFAOYSA-N |
| SMILES | CN(C1CCCCCCC1)C(=O)OC2=NSN=C2N3CCOCC3 |
Computed by PubChem (NCBI)