CAS 1449240-68-9 appears in our catalog under these names: K145 hydrochloride/ 99.09% (existing batch purity), K145 hydrochloride, K145 HCl 99%, K145 hydrochloride, 99%, 99%, K145 (hydrochloride), 99.63%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1mg, 100mg, 250mg, 25 mg.
(5Z)-3-(2-aminoethyl)-5-[3-(4-butoxyphenyl)propylidene]-1,3-thiazolidine-2,4-dione;hydrochloride (CAS 1449240-68-9) is a chemical compound with the molecular formula C18H25ClN2O3S and a molecular weight of 384.9 g/mol. IUPAC name: (5Z)-3-(2-aminoethyl)-5-[3-(4-butoxyphenyl)propylidene]-1,3-thiazolidine-2,4-dione;hydrochloride. InChIKey: HADFDMGQKBGVAV-NKBLJONXSA-N.
| Molecular formula | C18H25ClN2O3S |
|---|---|
| Molecular weight | 384.9 g/mol |
| IUPAC name | (5Z)-3-(2-aminoethyl)-5-[3-(4-butoxyphenyl)propylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
| InChIKey | HADFDMGQKBGVAV-NKBLJONXSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)CC/C=C\2/C(=O)N(C(=O)S2)CCN.Cl |
Computed by PubChem (NCBI)