CAS 756875-51-1 appears in our catalog under these names: K6PC-5/ 98.55% (existing batch purity), K6PC–5, N-(1,3-Dihydroxypropan-2-yl)-2-hexyl-3-oxodecanamide, K6PC-5, 99.90% ,, 99.90% ,, K6PC-5, 99.27%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
N-(1,3-dihydroxypropan-2-yl)-2-hexyl-3-oxodecanamide (CAS 756875-51-1) is a chemical compound with the molecular formula C19H37NO4 and a molecular weight of 343.5 g/mol. IUPAC name: N-(1,3-dihydroxypropan-2-yl)-2-hexyl-3-oxodecanamide. InChIKey: CGYVFCHCRBGGJG-UHFFFAOYSA-N.
| Molecular formula | C19H37NO4 |
|---|---|
| Molecular weight | 343.5 g/mol |
| IUPAC name | N-(1,3-dihydroxypropan-2-yl)-2-hexyl-3-oxodecanamide |
| InChIKey | CGYVFCHCRBGGJG-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)C(CCCCCC)C(=O)NC(CO)CO |
Computed by PubChem (NCBI)