CAS 1451255-59-6 appears in our catalog under these names: KAN0438757/ 99.8% (existing batch purity), KAN0438757, KAN0438757 99%, KAN0438757, ≥99%, ≥99%, KAN0438757, 99.41%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 25 mg.
2-hydroxyethyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylamino]-2-hydroxybenzoate (CAS 1451255-59-6) is a chemical compound with the molecular formula C21H18FNO7S and a molecular weight of 447.4 g/mol. IUPAC name: 2-hydroxyethyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylamino]-2-hydroxybenzoate. InChIKey: QRDFCYMUXHUTCS-UHFFFAOYSA-N.
| Molecular formula | C21H18FNO7S |
|---|---|
| Molecular weight | 447.4 g/mol |
| IUPAC name | 2-hydroxyethyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylamino]-2-hydroxybenzoate |
| InChIKey | QRDFCYMUXHUTCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=CC(=C(C=C2)C(=O)OCCO)O)C3=C(C=CC(=C3)F)O |
Computed by PubChem (NCBI)