CAS 946398-78-3 appears in our catalog under these names: KB-74935/ 99.28% (existing batch purity), KB-74935, 11β-HSD1-IN-15. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
3-chloro-4-[(2R)-4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylpiperazin-1-yl]sulfonylbenzamide (CAS 946398-78-3) is a chemical compound with the molecular formula C19H18ClF4N3O3S and a molecular weight of 479.9 g/mol. IUPAC name: 3-chloro-4-[(2R)-4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylpiperazin-1-yl]sulfonylbenzamide. InChIKey: OMWNFYWEMXUREB-LLVKDONJSA-N.
| Molecular formula | C19H18ClF4N3O3S |
|---|---|
| Molecular weight | 479.9 g/mol |
| IUPAC name | 3-chloro-4-[(2R)-4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylpiperazin-1-yl]sulfonylbenzamide |
| InChIKey | OMWNFYWEMXUREB-LLVKDONJSA-N |
| SMILES | C[C@@H]1CN(CCN1S(=O)(=O)C2=C(C=C(C=C2)C(=O)N)Cl)C3=C(C=C(C=C3)F)C(F)(F)F |
Computed by PubChem (NCBI)